BIOPEP-UWM: Report
| ID | 9616 |
| Name | HMG-CoA reductase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of HMG-CoA reductase (EC 1.1.1.34) | |||
| Number of residues | 6 |
Activity code | HMGi |
| Activity : | HMG-CoA reductase inhibitor |
|||
| Chemical mass | 684.7349 | Monoisotopic mass | 684.3108 | |
| IC50 : | 0.40 µM |
|||
| Bibliographic data: | |
| Authors | |
| Pak V. V., Koo M., Kim M. J., Yang H. J., Yun L., Kwon D. Y. | |
| Title | |
| Modeling an active conformation for linear peptides and design of a competitive inhibitor for HMG-CoA reductase. J. Mol. Recognit., 21, 224–232, 2008 | |
| Year | Source |
| 2008 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(Cc1ccccc1)C(=O)NCC(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O InChI=1S/C33H44N6O10/c1-18(2)28(32(47)36-19(3)29(44)38-24(33(48)49)13-14-27(42)43)39-31(46)25(16-21-9-11-22(40)12-10-21)37-26(41)17-35-30(45)23(34)15-20-7-5-4-6-8-20/h4-12,18-19,23-25,28,40H,13-17,34H2,1-3H3,(H,35,45)(H,36,47)(H,37,41)(H,38,44)(H,39,46)(H,42,43)(H,48,49)/t19-,23-,24-,25-,28-/m0/s1 InChIKey: PKVDOWYZGZDBDE-JGSJVDHVSA-N HMG-CoA reductase (EC 1.1.1.34) is involved in cholesterol biosynthesis. |
| Database reference: |