BIOPEP-UWM: Report
| ID | 9618 |
| Name | HMG-CoA reductase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of HMG-CoA reductase (EC 1.1.1.34) | |||
| Number of residues | 8 |
Activity code | HMGi |
| Activity : | HMG-CoA reductase inhibitor |
|||
| Chemical mass | 708.7150 | Monoisotopic mass | 708.3068 | |
| IC50 : | 760.70 µM |
|||
| Bibliographic data: | |
| Authors | |
| Pak V. V., Koo M., Kim M. J., Yang H. J., Yun L., Kwon D. Y. | |
| Title | |
| Modeling an active conformation for linear peptides and design of a competitive inhibitor for HMG-CoA reductase. J. Mol. Recognit., 21, 224–232, 2008 | |
| Year | Source |
| 2008 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)NCC(=O)NCC(=O)NCC(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O InChI=1S/C30H44N8O12/c1-15(2)26(29(48)35-16(3)27(46)37-19(30(49)50)8-9-25(44)45)38-28(47)20(10-17-4-6-18(39)7-5-17)36-24(43)14-34-23(42)13-33-22(41)12-32-21(40)11-31/h4-7,15-16,19-20,26,39H,8-14,31H2,1-3H3,(H,32,40)(H,33,41)(H,34,42)(H,35,48)(H,36,43)(H,37,46)(H,38,47)(H,44,45)(H,49,50)/t16-,19-,20-,26-/m0/s1 InChIKey: VEGJJLYVSSPVHH-CPNZKCELSA-N HMG-CoA reductase (EC 1.1.1.34) is involved in cholesterol biosynthesis. |
| Database reference: |