BIOPEP-UWM: Report
| ID | 9620 |
| Name | Anticancer peptide |
| sequence |
| Function: | |||
| Anticancer | |||
| Number of residues | 6 |
Activity code | ac |
| Activity : | anticancer |
|||
| Chemical mass | 783.9118 | Monoisotopic mass | 783.4266 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Hatzoglou A., Bakogeorgou E., Hatzoglou C., Martin P.-M., Castanas E. | |
| Title | |
| Antiproliferative and receptor binding properties of α- and β-casomorphins in the T47D human breast cancer cell line. Eur. J. Pharmacol., 310, 217-223, 1996 | |
| Year | Source |
| 1996 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCCNC(N)=N)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(CC(C)C)C(=O)NCC(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(CC(C)C)C(O)=O InChI=1S/C38H57N9O9/c1-21(2)16-28(46-36(54)30(19-24-9-13-26(49)14-10-24)45-33(51)27(39)6-5-15-42-38(40)41)34(52)43-20-32(50)44-29(18-23-7-11-25(48)12-8-23)35(53)47-31(37(55)56)17-22(3)4/h7-14,21-22,27-31,48-49H,5-6,15-20,39H2,1-4H3,(H,43,52)(H,44,50)(H,45,51)(H,46,54)(H,47,53)(H,55,56)(H4,40,41,42)/t27-,28-,29-,30-,31-/m0/s1 InChI=1S/C40H68N14O16/c1-20(31(61)50-24(17-55)35(65)51-25(18-56)34(64)49-22(8-2-3-11-41)37(67)54-14-6-10-28(54)39(69)70)47-36(66)27-9-5-13-53(27)38(68)26(19-57)52-33(63)23(15-30(59)60)48-29(58)16-46-32(62)21(42)7-4-12-45-40(43)44/h20-28,55-57H,2-19,41-42H2,1H3,(H,46,62)(H,47,66)(H,48,58)(H,49,64)(H,50,61)(H,51,65)(H,52,63)(H,59,60)(H,69,70)(H4,43,44,45)/t20-,21-,22-,23-,24-,25-,26-,27-,28-/m0/s1 InChIKey=KWLNZVXBGCEDOO-QKUYTOGTSA-N Opioid peptide according to the BIOPEP-UWM database of bioactive peptides (ID 3128); the EROP-Moscow database; the MBPDB database |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 3128 ChemIDplus: ID 83471-50-5 ChemSpider: ID 118381 EROP-Moscow: ID E00398 J-GLOBAL: ID 200907030126230881 MBPDB: Peptide RYLGYL Nikkaji: ID J366.923H PepBank: Peptide RYLGYL PubChem: CID 134288 |