BIOPEP-UWM: Report
| ID | 9638 |
| Name | Hypolipidemic peptide |
| sequence |
| Function: | |||
| hypolipidemic | |||
| Number of residues | 11 |
Activity code | hypl |
| Activity : | hypolipidemic |
|||
| Chemical mass | 1146.3644 | Monoisotopic mass | 1145.4764 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Fan X., Cui Y., Zhang R., Zhang X. | |
| Title | |
| Purification and identification of anti-obesity peptides derived from Spirulina platensis. J. Funct. Foods, 47, 350–360, 2018 | |
| Year | Source |
| 2018 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC(=O)N)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CS)C(=O)N[C@@H](CS)C(=O)N[C@@H](CC1=C[N]([H])C=N1)C(=O)N[C@@H](CO)C(=O)N[C@@H](CS)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](C)C(=O)O InChI=1S/C45H75N15O14S3/c1-21(2)12-27(54-35(63)22(3)51-36(64)25(47)14-34(48)62)38(66)53-26(8-5-6-10-46)37(65)57-31(18-76)42(70)58-30(17-75)41(69)55-28(13-24-15-49-20-50-24)39(67)56-29(16-61)40(68)59-32(19-77)44(72)60-11-7-9-33(60)43(71)52-23(4)45(73)74/h15,20-23,25-33,61,75-77H,5-14,16-19,46-47H2,1-4H3,(H2,48,62)(H,49,50)(H,51,64)(H,52,71)(H,53,66)(H,54,63)(H,55,69)(H,56,67)(H,57,65)(H,58,70)(H,59,68)(H,73,74)/t22-,23-,25-,26-,27-,28-,29-,30-,31-,32-,33-/m0/s1 InChIKey: ADVUNLDIDMAYJF-PYPILKHJSA-N |
| Database reference: |