BIOPEP-UWM: Report
| ID | 9640 |
| Name | Hypolipidemic peptide |
| sequence |
| Function: | |||
| hypolipidemic | |||
| Number of residues | 7 |
Activity code | hypl |
| Activity : | hypolipidemic |
|||
| Chemical mass | 927.1015 | Monoisotopic mass | 926.5435 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Fan X., Cui Y., Zhang R., Zhang X. | |
| Title | |
| Purification and identification of anti-obesity peptides derived from Spirulina platensis. J. Funct. Foods, 47, 350–360, 2018 | |
| Year | Source |
| 2018 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC(=O)N)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC2=C[N]([H])C3=CC=CC=C23)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCCN)C(=O)O InChI=1S/C43H70N14O9/c1-24(2)35(56-39(62)33-16-10-20-57(33)41(64)27(46)22-34(47)58)40(63)55-32(21-25-23-51-28-12-4-3-11-26(25)28)38(61)53-29(13-5-7-17-44)36(59)52-30(15-9-19-50-43(48)49)37(60)54-31(42(65)66)14-6-8-18-45/h3-4,11-12,23-24,27,29-33,35,51H,5-10,13-22,44-46H2,1-2H3,(H2,47,58)(H,52,59)(H,53,61)(H,54,60)(H,55,63)(H,56,62)(H,65,66)(H4,48,49,50)/t27-,29-,30-,31-,32-,33-,35-/m0/s1 InChIKey: ZGYGAXCSRYPQHZ-JGDVQNAXSA-N |
| Database reference: |