BIOPEP-UWM: Report
| ID | 9641 |
| Name | Hypolipidemic peptide |
| sequence |
| Function: | |||
| hypolipidemic | |||
| Number of residues | 10 |
Activity code | hypl |
| Activity : | hypolipidemic |
|||
| Chemical mass | 1122.2530 | Monoisotopic mass | 1121.5271 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Fan X., Cui Y., Zhang R., Zhang X. | |
| Title | |
| Purification and identification of anti-obesity peptides derived from Spirulina platensis. J. Funct. Foods, 47, 350–360, 2018 | |
| Year | Source |
| 2018 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CS)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(=O)N)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC2=C[N]([H])C=N2)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(C)C)C(=O)N3[C@@H](CCC3)C(=O)N[C@@H](CC(=O)N)C(=O)N[C@@H](CCCCN)C(=O)O InChI=1S/C47H75N15O15S/c1-23(2)16-31(45(74)61-14-6-10-34(61)44(73)58-30(18-35(50)63)42(71)56-28(47(76)77)8-4-5-13-48)60-40(69)27(11-12-37(65)66)55-41(70)29(17-25-20-52-22-53-25)57-43(72)33-9-7-15-62(33)46(75)32(19-36(51)64)59-38(67)24(3)54-39(68)26(49)21-78/h20,22-24,26-34,78H,4-19,21,48-49H2,1-3H3,(H2,50,63)(H2,51,64)(H,52,53)(H,54,68)(H,55,70)(H,56,71)(H,57,72)(H,58,73)(H,59,67)(H,60,69)(H,65,66)(H,76,77)/t24-,26-,27-,28-,29-,30-,31-,32-,33-,34-/m0/s1 InChIKey: ZPAYXAMKTJHDPB-WHBJAZBXSA-N |
| Database reference: |