BIOPEP-UWM: Report
| ID | 9647 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 8 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 964.9662 | Monoisotopic mass | 964.4010 | |
| IC50 : | 5580.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Mora L., González-Rogel D., Heres A., Toldrá F. | |
| Title | |
| Iberian dry-cured ham as a potential source of α-glucosidase-inhibitory peptides. J. Funct. Foods, 67, 103840, 2020 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C42H60N8O18/c1-20(2)17-29(42(67)68)49-39(64)27(19-34(58)59)47-40(65)30-5-4-16-50(30)41(66)28(18-22-6-8-23(51)9-7-22)48-38(63)26(12-15-33(56)57)46-37(62)25(11-14-32(54)55)45-36(61)24(10-13-31(52)53)44-35(60)21(3)43/h6-9,20-21,24-30,51H,4-5,10-19,43H2,1-3H3,(H,44,60)(H,45,61)(H,46,62)(H,47,65)(H,48,63)(H,49,64)(H,52,53)(H,54,55)(H,56,57)(H,58,59)(H,67,68)/t21-,24-,25-,26-,27-,28-,29-,30-/m0/s1 InChIKey: HPEAVETYNNMCQU-DYYMGMNTSA-N |
| Database reference: |