BIOPEP-UWM: Report
| ID | 9648 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 5 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 401.4567 | Monoisotopic mass | 401.2267 | |
| IC50 : | 6360.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Mora L., González-Rogel D., Heres A., Toldrá F. | |
| Title | |
| Iberian dry-cured ham as a potential source of α-glucosidase-inhibitory peptides. J. Funct. Foods, 67, 103840, 2020 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)NCC(=O)N[C@@]([H])(C(C)C)C(=O)NCC(=O)NCC(=O)O InChI=1S/C17H31N5O6/c1-9(2)5-11(18)16(27)20-7-13(24)22-15(10(3)4)17(28)21-6-12(23)19-8-14(25)26/h9-11,15H,5-8,18H2,1-4H3,(H,19,23)(H,20,27)(H,21,28)(H,22,24)(H,25,26)/t11-,15-/m0/s1 InChIKey: NLEKLJARFXZLKE-NHYWBVRUSA-N |
| Database reference: |