BIOPEP-UWM: Report
| ID | 9649 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 5 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 399.4409 | Monoisotopic mass | 399.2111 | |
| IC50 : | 8710.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Mora L., González-Rogel D., Heres A., Toldrá F. | |
| Title | |
| Iberian dry-cured ham as a potential source of α-glucosidase-inhibitory peptides. J. Funct. Foods, 67, 103840, 2020 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)NCC(=O)N[C@@]([H])(CC(C)C)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C17H29N5O6/c1-10(2)6-11(21-14(24)8-19-13(23)7-18)16(26)20-9-15(25)22-5-3-4-12(22)17(27)28/h10-12H,3-9,18H2,1-2H3,(H,19,23)(H,20,26)(H,21,24)(H,27,28)/t11-,12-/m0/s1 InChIKey: KBANISKPBNBYEP-RYUDHWBXSA-N |
| Database reference: |