BIOPEP-UWM: Report
| ID | 9653 |
| Name | Antihypertensive peptide derived from egg white |
| sequence |
| Function: | |||
| Lowering blood pressure in vivo in rats | |||
| Number of residues | 5 |
Activity code | hyp |
| Activity : | hypotensive |
|||
| Chemical mass | 594.6192 | Monoisotopic mass | 594.2866 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Miguel M., Ramos M., Aleixandre M.A., López-Fandino R. | |
| Title | |
| Antihypertensive peptides obtained from egg white proteins by enzymatic hydrolysis, stability under simulated gastrointestinal digestion. J. Agric. Food Chem., Vol. 54, No. 3, 726-731, 2006 | |
| Year | Source |
| 2006 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC1=C[N]([H])C=N1)C(=O)N2[C@@H](CCC2)C(=O)O InChI=1S/C24H38N10O8/c1-12(31-20(38)14(25)4-2-6-29-24(26)27)19(37)32-15(9-18(35)36)21(39)33-16(8-13-10-28-11-30-13)22(40)34-7-3-5-17(34)23(41)42/h10-12,14-17H,2-9,25H2,1H3,(H,28,30)(H,31,38)(H,32,37)(H,33,39)(H,35,36)(H,41,42)(H4,26,27,29)/t12-,14-,15-,16-,17-/m0/s1 InChIKey=GMZGWULVRBHSMA-SRQBIAJPSA-N |
| Database reference: |
| AHTPDB: ID 2899, 5736 BioPepDB: ID biopep01172 ChemSpider: ID 10151792 J-GLOBAL: ID 200907088442673904 Nikkaji: ID J2.458.216G PubChem: CID 11978450 SATPdb: ID satpdb26687 |