BIOPEP-UWM: Report
| ID | 9656 |
| Name | Antihypertensive peptide derived from spinach Rubisco |
| sequence |
| Function: | |||
| Antihypertensive effect after oral administration to spontaneously hypertensive rats | |||
| Number of residues | 7 |
Activity code | hyp |
| Activity : | hypotensive |
|||
| Chemical mass | 718.8386 | Monoisotopic mass | 718.4001 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Yang Y., Marczak E.D., Yokoo M., Usui H., Yoshikawa M. | |
| Title | |
| Isolation and antihypertensive effect of angiotensin I-converting enzyme (ACE) inhibitory peptides from spinach Rubisco. J. Agric. Food. Chem. 51(17): 4897-4902, 2003 | |
| Year | Source |
| 2003 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(CCCCN)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C)C(=O)NCC(=O)O InChI=1S/C34H54N8O9/c1-5-19(2)28(36)33(50)39-21(4)30(47)41-25(17-22-11-13-23(43)14-12-22)31(48)40-24(9-6-7-15-35)34(51)42-16-8-10-26(42)32(49)38-20(3)29(46)37-18-27(44)45/h11-14,19-21,24-26,28,43H,5-10,15-18,35-36H2,1-4H3,(H,37,46)(H,38,49)(H,39,50)(H,40,48)(H,41,47)(H,44,45)/t19-,20-,21-,24-,25-,26-,28-/m0/s1 InChIKey=GPOHMCMFILTZSA-NTHYOZQESA-N Inhibitor of Angiotensin-converting enzyme (ACE) (EC 3.4.15.1; MEROPS ID: M02-001) according to the AHTPDB database; the BIOPEP-UWM database of bioactive peptides (ID 9665); the EROP-Moscow database |
| Database reference: |
| AHTPDB: ID 2329, 2576, 6227 BioPepDB: ID biopep00493 BIOPEP-UWM database of bioactive peptides: ID 9665 EROP-Moscow: ID E09160 PubChem: CID 25003677 SATPdb: ID satpdb15752 |