BIOPEP-UWM: Report
| ID | 9660 |
| Name | Antithrombotic peptide |
| sequence |
| Function: | |||
| Integrin ligand | |||
| Number of residues | 3 |
Activity code | at |
| Activity : | antithrombotic |
|||
| Chemical mass | 346.3388 | Monoisotopic mass | 346.1596 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Feuston B. P., Culberson J. C., Hartman G. D. | |
| Title | |
| Molecular model of the alpha(IIb)beta(3) integrin. J. Med. Chem., 46, 5316-5325, 2003 | |
| Year | Source |
| 2003 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCCNC(N)=N)C(=O)NCC(=O)N[C@@]([H])(CC(O)=O)C(O)=O InChI=1S/C12H22N6O6/c13-6(2-1-3-16-12(14)15)10(22)17-5-8(19)18-7(11(23)24)4-9(20)21/h6-7H,1-5,13H2,(H,17,22)(H,18,19)(H,20,21)(H,23,24)(H4,14,15,16)/t6-,7-/m0/s1 InChIKey=IYMAXBFPHPZYIK-BQBZGAKWSA-N Embryotoxic peptide according to the BIOPEP-UWM database of bioactive peptides (ID 3164), the EROP-Moscow database |
| Database reference: |
| ACToR: ID 99896-85-2 BindingDB: ID 50107402 BIOPEP-UWM database of bioactive peptides: ID 3164 BRENDA: Ligand Arg-Gly-Asp ChEMBL: ID CHEMBL313763 ChemIDplus: ID 99896-85-2 ChemSpider: ID 94603 CTD: ID 99896-85-2 Drug Information Portal: compound Arginyl-glycyl-aspartic acid EROP-Moscow: ID E09294 FDA SRS: ID 78VO7F77PN J-GLOBAL: ID 200907026262885193 Nikkaji: ID J475.976A PepBank: Peptide RGD PubChem: CID 104802 SureChEMBL: ID SCHEMBL19139 ZINC: ID ZINC000003922521 |