BIOPEP-UWM: Report
| ID | 9664 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-converting enzyme (ACE) (EC 3.4.15.1; MEROPS ID: M02-001) | |||
| Number of residues | 5 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 762.8791 | Monoisotopic mass | 762.3585 | |
| IC50 : | 2.10 µM |
|||
| Bibliographic data: | |
| Authors | |
| Yang Y., Marczak E.D., Yokoo M., Usui H., Yoshikawa M. | |
| Title | |
| Isolation and antihypertensive effect of angiotensin I-converting enzyme (ACE) inhibitory peptides from spinach Rubisco. J. Agric. Food. Chem., 51(17): 4897-4902, 2003 | |
| Year | Source |
| 2003 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CCSC)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC1=C[N]([H])C2=CC=CC=C12)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(=O)O)C(=O)O InChI=1S/C32H50N12O8S/c1-53-13-10-19(33)26(47)41-21(8-4-11-38-31(34)35)27(48)43-23(14-17-16-40-20-7-3-2-6-18(17)20)29(50)42-22(9-5-12-39-32(36)37)28(49)44-24(30(51)52)15-25(45)46/h2-3,6-7,16,19,21-24,40H,4-5,8-15,33H2,1H3,(H,41,47)(H,42,50)(H,43,48)(H,44,49)(H,45,46)(H,51,52)(H4,34,35,38)(H4,36,37,39)/t19-,21-,22-,23-,24-/m0/s1 InChIKey: SMZWMXSYYZOAMD-DUSBTPNUSA-N Antihypertensive peptide according to the BIOPEP-UWM database of bioactive peptides (ID 9655) |
| Database reference: |
| AHTPDB: ID 1922, 2315, 2573, 5331, 6228 BioPepDB: ID biopep00982 BIOPEP-UWM database of bioactive peptides: ID 9655 ChemSpider: ID 818594 EROP-Moscow: ID E09161 J-GLOBAL: ID 200907009703006687 Nikkaji: ID J1.754.753D PubChem: CID 10010362 SATPdb: ID satpdb13657 |