BIOPEP-UWM: Report
| ID | 9682 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 4 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 488.5751 | Monoisotopic mass | 488.2626 | |
| IC50 : | 5.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Dellafiora L., Pugliese R., Bollati C., Gelain F., Galaverna G., Arnoldi A., Lammi C. | |
| Title | |
| "Bottom-Up" strategy for the identification of novel soybean peptides with angiotensin-converting enzyme inhibitory activity. J. Agric. Food Chem., 68, 2082-2090, 2020 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C25H36N4O6/c1-15(2)13-18(26)23(32)28-11-3-5-20(28)22(31)27-19(14-16-7-9-17(30)10-8-16)24(33)29-12-4-6-21(29)25(34)35/h7-10,15,18-21,30H,3-6,11-14,26H2,1-2H3,(H,27,31)(H,34,35)/t18-,19-,20-,21-/m0/s1 InChIKey: NRJZAOVJHXKFRI-TUFLPTIASA-N Inhibitor of HMG-CoA reductase (EC 1.1.1.34) according to the BindingDB database; the BIOPEP-UWM database of bioactive peptides (ID 9605); the BRENDA database; the ChEMBL database |
| Database reference: |
| BindingDB: ID 50226159 BIOPEP-UWM database of bioactive peptides: ID 9605 BRENDA: Ligand LPYP ChEMBL: ID CHEMBL412060 ChemSpider: ID 23319380 EPA CompTox: ID DTXSID90659167 EPA DSSTox: ID DTXCID00609916 J-GLOBAL: ID 201707003233025250 Nikkaji: ID J3.595.388D PubChem: CID 44451976 |