BIOPEP-UWM: Report
| ID | 9685 |
| Name | Antidiabetic peptide from goat milk β-casein, f30–40 |
| sequence |
| Function: | |||
| Ameliorating high-glucose-induced insulin resistance in HepG2 cells | |||
| Number of residues | 11 |
Activity code | adb |
| Activity : | antidiabetic |
|||
| Chemical mass | 1176.1851 | Monoisotopic mass | 1175.5287 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Gong H., Gao J., Wang Y., Luo Q.W., Guo K.R., Ren F.Z., Mao X.Y. | |
| Title | |
| Identification of novel peptides from goat milk casein that ameliorate high-glucose-induced insulin resistance in HepG2 cells. J. Dairy Sci., 103, 4907-4918, 2020 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)O InChI=1S/C47H77N13O22/c1-6-21(4)35(45(79)60-36(22(5)66)46(80)54-28(47(81)82)12-23-13-49-19-50-23)59-44(78)32(18-65)55-39(73)26(8-10-34(69)70)51-38(72)25(7-9-33(67)68)52-41(75)29(15-62)57-43(77)31(17-64)58-42(76)30(16-63)56-40(74)27(11-20(2)3)53-37(71)24(48)14-61/h13,19-22,24-32,35-36,61-66H,6-12,14-18,48H2,1-5H3,(H,49,50)(H,51,72)(H,52,75)(H,53,71)(H,54,80)(H,55,73)(H,56,74)(H,57,77)(H,58,76)(H,59,78)(H,60,79)(H,67,68)(H,69,70)(H,81,82)/t21-,22+,24-,25-,26-,27-,28-,29-,30-,31-,32-,35-,36-/m0/s1 InChIKey=JSRRHOCCGBYTBO-CKOPEUTBSA-N |
| Database reference: |