BIOPEP-UWM: Report
| ID | 9691 |
| Name | Antibacterial peptide from pig |
| sequence |
| Function: | |||
| Ability to bind to LPS components and increasing membrane permeability | |||
| Number of residues | 12 |
Activity code | ab |
| Activity : | antibacterial |
|||
| Chemical mass | 1539.9455 | Monoisotopic mass | 1538.9785 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lyu Y., Yang C., Chen T., Shang L., Yang Y., Li J., Shan A., Xiang W., Cheng B., Zhang L. | |
| Title | |
| Characterization of an antibacterial dodecapeptide from pig as a potential food preservative and its antibacterial mechanism. Food Funct., article in press, Doi: https://doi.org/10.1039/D0FO00380H, 2020 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC1=C[N]([H])C2=CC=CC=C12)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H]([C@H](CC)C)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC3=C[N]([H])C4=CC=CC=C34)C(=O)N[C@@H]([C@H](CC)C)C(=O)O InChI=1S/C77H126N20O13/c1-11-46(9)64(96-69(102)57(31-19-22-34-80)90-72(105)60(38-48-40-85-53-27-15-13-24-50(48)53)93-71(104)58(36-43(3)4)91-66(99)52(81)26-23-35-84-77(82)83)74(107)87-42-62(98)88-55(29-17-20-32-78)68(101)95-63(45(7)8)75(108)94-59(37-44(5)6)70(103)89-56(30-18-21-33-79)67(100)92-61(73(106)97-65(76(109)110)47(10)12-2)39-49-41-86-54-28-16-14-25-51(49)54/h13-16,24-25,27-28,40-41,43-47,52,55-61,63-65,85-86H,11-12,17-23,26,29-39,42,78-81H2,1-10H3,(H,87,107)(H,88,98)(H,89,103)(H,90,105)(H,91,99)(H,92,100)(H,93,104)(H,94,108)(H,95,101)(H,96,102)(H,97,106)(H,109,110)(H4,82,83,84)/t46-,47-,52-,55-,56-,57-,58-,59-,60-,61-,63-,64-,65-/m0/s1 InChIKey= XYJXJXAGKHZGSD-FCENNQHLSA-N |
| Database reference: |