BIOPEP-UWM: Report
| ID | 9721 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 8 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 939.0611 | Monoisotopic mass | 938.4523 | |
| EC50 : | 10.01 µM |
|||
| Bibliographic data: | |
| Authors | |
| Montone, C. M., Zenezini Chiozzi, R., Marchetti, N., Cerrato, A., Antonelli, M., Capriotti, A. L., Cavaliere C., Piovesana S.,Laganà A. | |
| Title | |
| Peptidomic Approach for the Identification of Peptides with Potential Antioxidant and Anti-Hyperthensive Effects Derived From Asparagus By-Products. Molecules, 24(19), 3627, 2019 | |
| Year | Source |
| 2019 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](C)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](C(C)C)C(=O)N3[C@@H](CCC3)C(=O)N[C@@H](CC4=CC=CC=C4)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC5=CC=CC=C5)C(=O)O InChI=1S/C49H62N8O11/c1-29(2)41(55-46(64)39-22-13-23-56(39)47(65)30(3)51-42(60)34(50)25-31-15-7-4-8-16-31)48(66)57-24-14-21-38(57)45(63)53-35(26-32-17-9-5-10-18-32)43(61)52-36(28-40(58)59)44(62)54-37(49(67)68)27-33-19-11-6-12-20-33/h4-12,15-20,29-30,34-39,41H,13-14,21-28,50H2,1-3H3,(H,51,60)(H,52,61)(H,53,63)(H,54,62)(H,55,64)(H,58,59)(H,67,68)/t30-,34-,35-,36-,37-,38-,39-,41-/m0/s1 InChIKey: UIPPCGLSKJBCFM-BCKJFBNVSA-N |
| Database reference: |