BIOPEP-UWM: Report
| ID | 9723 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 10 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1236.4598 | Monoisotopic mass | 1235.6795 | |
| EC50 : | 6.76 µM |
|||
| Bibliographic data: | |
| Authors | |
| Montone, C. M., Zenezini Chiozzi, R., Marchetti, N., Cerrato, A., Antonelli, M., Capriotti, A. L., Cavaliere C., Piovesana S.,Laganà A. | |
| Title | |
| Peptidomic Approach for the Identification of Peptides with Potential Antioxidant and Anti-Hyperthensive Effects Derived From Asparagus By-Products. Molecules, 24(19), 3627, 2019 | |
| Year | Source |
| 2019 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H]([C@H](CC)C)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(=O)N)C(=O)N[C@@H](CC2=CC=CC=C2)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CC3=C[N]([H])C4=CC=CC=C34)C(=O)O InChI=1S/C62H89N15O12/c1-8-36(6)52(77-54(81)42(63)28-38-18-11-9-12-19-38)60(87)70-37(7)53(80)72-44(24-17-25-67-62(65)66)56(83)76-48(31-50(64)78)59(86)75-47(29-39-20-13-10-14-21-39)58(85)74-46(27-35(4)5)57(84)73-45(26-34(2)3)55(82)69-33-51(79)71-49(61(88)89)30-40-32-68-43-23-16-15-22-41(40)43/h9-16,18-23,32,34-37,42,44-49,52,68H,8,17,24-31,33,63H2,1-7H3,(H2,64,78)(H,69,82)(H,70,87)(H,71,79)(H,72,80)(H,73,84)(H,74,85)(H,75,86)(H,76,83)(H,77,81)(H,88,89)(H4,65,66,67)/t36-,37-,42-,44-,45-,46-,47-,48-,49-,52-/m0/s1 InChIKey: HBOXKEMKFSUVMV-GJKIBFLGSA-N |
| Database reference: |