BIOPEP-UWM: Report
| ID | 9727 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 330.3823 | Monoisotopic mass | 330.2010 | |
| IC50 : | 166.50 µM |
|||
| Bibliographic data: | |
| Authors | |
| Manoharan S., Shuib A. S., Abdullah N., Bin Mohamad S., Aminudin N. | |
| Title | |
| Characterisation of novel angiotensin-I-converting enzyme inhibitory tripeptide, Gly-Val-Arg derived from mycelium of Pleurotus pulmonarius. Process Biochem., 62, 215–222, 2017 | |
| Year | Source |
| 2017 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C13H26N6O4/c1-7(2)10(19-9(20)6-14)11(21)18-8(12(22)23)4-3-5-17-13(15)16/h7-8,10H,3-6,14H2,1-2H3,(H,18,21)(H,19,20)(H,22,23)(H4,15,16,17)/t8-,10-/m0/s1 InChIKey=GJHWILMUOANXTG-WPRPVWTQSA-N Hypotensive peptide according to the BIOPEP-UWM database of bioactive peptides (ID 9728) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 9728 J-GLOBAL: ID 200907053747971915 Nikkaji: ID J2.059.414D PubChem: CID 101736690 |