BIOPEP-UWM: Report
| ID | 9730 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 385.4177 | Monoisotopic mass | 385.2068 | |
| IC50 : | 285.40 µM |
|||
| Bibliographic data: | |
| Authors | |
| Manoharan S., Shuib A. S., Abdullah N., Bin Mohamad S., Aminudin N. | |
| Title | |
| Characterisation of novel angiotensin-I-converting enzyme inhibitory tripeptide, Gly-Val-Arg derived from mycelium of Pleurotus pulmonarius. Process Biochem., 62, 215–222, 2017 | |
| Year | Source |
| 2017 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)N)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C15H27N7O5/c16-8(7-11(17)23)13(25)22-6-2-4-10(22)12(24)21-9(14(26)27)3-1-5-20-15(18)19/h8-10H,1-7,16H2,(H2,17,23)(H,21,24)(H,26,27)(H4,18,19,20)/t8-,9-,10-/m0/s1 InChIKey=QXOPPIDJKPEKCW-GUBZILKMSA-N |
| Database reference: |
| PubChem: CID 145454234 |