BIOPEP-UWM: Report
| ID | 9732 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 8 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 769.8836 | Monoisotopic mass | 769.4320 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kęska P., Stadnik J. | |
| Title | |
| Ageing-Time Dependent Changes of Angiotensin I-Converting Enzyme-Inhibiting Activity of Protein Hydrolysates Obtained from Dry-Cured Pork Loins Inoculated with Probiotic Lactic Acid Bacteria. Int. J. Pept. Res.Ther., 25, 1173–1185, 2019 | |
| Year | Source |
| 2019 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CCCCN)C(=O)N[C@@H](CCC(=O)O)C(=O)NCC(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC(C)C)C(=O)O InChI=1S/C34H59N9O11/c1-19(2)14-23(32(51)39-18-28(46)43-13-7-9-25(43)33(52)42-24(34(53)54)15-20(3)4)40-27(45)17-37-26(44)16-38-31(50)22(10-11-29(47)48)41-30(49)21(36)8-5-6-12-35/h19-25H,5-18,35-36H2,1-4H3,(H,37,44)(H,38,50)(H,39,51)(H,40,45)(H,41,49)(H,42,52)(H,47,48)(H,53,54)/t21-,22-,23-,24-,25-/m0/s1 InChIKey=JRWCSCHLICDGGB-KEOOTSPTSA-N |
| Database reference: |