BIOPEP-UWM: Report
| ID | 9733 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 6 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 658.8062 | Monoisotopic mass | 658.3348 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ashok A., Brijesha N., H S Aparna H.S. | |
| Title | |
| Discovery, synthesis, and in vitro evaluation of a novel bioactive peptide for ACE and DPP-IV inhibitory activity. Eur. J. Med. Chem., 180, 15, 99-110, 2019 | |
| Year | Source |
| 2019 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@H]([C@H](CC)C)C(=O)N[C@@H](CCC(=O)O)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(C)C)C(=O)O InChI=1S/C29H50N6O9S/c1-6-17(4)24(34-22(36)15-30)27(41)32-19(9-10-23(37)38)28(42)35-12-7-8-21(35)26(40)31-18(11-13-45-5)25(39)33-20(29(43)44)14-16(2)3/h16-21,24H,6-15,30H2,1-5H3,(H,31,40)(H,32,41)(H,33,39)(H,34,36)(H,37,38)(H,43,44)/t17-,18-,19-,20-,21-,24-/m0/s1 InChIKey=JVXLCPCWUUHZFX-WLUSOVMFSA-N |
| Database reference: |