BIOPEP-UWM: Report
| ID | 9761 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 5 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 570.6770 | Monoisotopic mass | 570.3366 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Fan H., Wang J., Liao W., Jiang J., Wu J. | |
| Title | |
| Identification and characterization of gastrointestinal-resistant angiotensin-converting enzyme inhibitory peptides from egg white proteins. J. Agric. Food Chem., 67, 7147−7156, 2019 | |
| Year | Source |
| 2019 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CC(=O)O)C(=O)O InChI=1S/C26H46N6O8/c1-14(2)12-18(30-25(38)21(15(3)4)32-22(35)16-9-7-11-28-16)24(37)29-17(8-5-6-10-27)23(36)31-19(26(39)40)13-20(33)34/h14-19,21,28H,5-13,27H2,1-4H3,(H,29,37)(H,30,38)(H,31,36)(H,32,35)(H,33,34)(H,39,40)/t16-,17-,18-,19-,21-/m0/s1 InChIKey=HDZOQWQIJUQTAS-JLCRNFDHSA-N |
| Database reference: |