BIOPEP-UWM: Report
| ID | 9770 |
| Name | stimulating peptide |
| sequence |
| Function: | |||
| Number of residues | 6 |
Activity code | sti |
| Activity : | stimulating |
|||
| Chemical mass | 835.9482 | Monoisotopic mass | 835.4651 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Sawicka J., Dzierżynska M.J., Wardowska A, Deptuła M., Rogujski P., Sosnowski P., Filipowicz N., Mieczkowska A., Sass P., Pawlik A., Hać A., Schumache | |
| Title | |
| Imunofan—RDKVYR Peptide—Stimulates Skin Cell Proliferation and Promotes Tissue Repair, Molecules, 25 (12), 2884 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C36H61N13O10/c1-19(2)28(33(57)48-25(17-20-10-12-21(50)13-11-20)31(55)46-24(34(58)59)9-6-16-44-36(41)42)49-30(54)23(8-3-4-14-37)45-32(56)26(18-27(51)52)47-29(53)22(38)7-5-15-43-35(39)40/h10-13,19,22-26,28,50H,3-9,14-18,37-38H2,1-2H3,(H,45,56)(H,46,55)(H,47,53)(H,48,57)(H,49,54)(H,51,52)(H,58,59)(H4,39,40,43)(H4,41,42,44)/t22-,23-,24-,25-,26-,28-/m0/s1 InChIKey=UIPUKCRNGDAFKO-BIVGDOEESA-N Antioxidative peptide according to the BIOPEP-UWM database of bioactive peptides (ID 9772) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 9772 PubChem: CID 15788399 |