BIOPEP-UWM: Report
| ID | 9774 |
| Name | Prolyl endopeptidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Prolyl Endopeptidase (EC 3.4.21.26) (MEROPS ID: S09.001) | |||
| Number of residues | 5 |
Activity code | am |
| Activity : | antiamnestic |
|||
| Chemical mass | 635.7486 | Monoisotopic mass | 635.3308 | |
| IC50 : | 87.70 µM |
|||
| Bibliographic data: | |
| Authors | |
| Yanai T., Suzuki Y., Sato M. | |
| Title | |
| Prolyl Endopeptidase Inhibitory Peptides in Wine. Bioscience, Biotechnology, and Biochemistry, 67(2), 380–382, 2003 | |
| Year | Source |
| 2003 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O InChI=1S/C34H45N5O7/c1-3-21(2)29(37-31(42)28-12-7-17-38(28)32(43)25(35)19-23-13-15-24(40)16-14-23)33(44)39-18-8-11-27(39)30(41)36-26(34(45)46)20-22-9-5-4-6-10-22/h4-6,9-10,13-16,21,25-29,40H,3,7-8,11-12,17-20,35H2,1-2H3,(H,36,41)(H,37,42)(H,45,46)/t21-,25-,26-,27-,28-,29-/m0/s1 InChIKey: CVIOOPXLWWMJDA-XLWWOFJKSA-N |
| Database reference: |
| BRENDA: Ligand Tyr-Pro-Ile-Pro-Phe ChemSpider: ID 8297632 J-GLOBAL: ID 200907098999781900 Nikkaji: ID J1.559.066A |