BIOPEP-UWM: Report
| ID | 9813 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 5 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 670.7117 | Monoisotopic mass | 670.3065 | |
| IC50 : | 1350.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ma F.-F., Wang H., Wei C.-K., Thakur K., Wei Z.-J., Jiang L. | |
| Title | |
| Three Novel ACE Inhibitory Peptides Isolated From Ginkgo biloba Seeds: Purification, Inhibitory Kinetic and Mechanism. Front. Pharmacol., 9, 1579, 2019 | |
| Year | Source |
| 2019 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)O InChI=1S/C31H42N8O9/c1-17(36-27(44)21(32)8-5-13-35-31(33)34)26(43)37-23(16-25(41)42)29(46)38-22(14-18-6-3-2-4-7-18)28(45)39-24(30(47)48)15-19-9-11-20(40)12-10-19/h2-4,6-7,9-12,17,21-24,40H,5,8,13-16,32H2,1H3,(H,36,44)(H,37,43)(H,38,46)(H,39,45)(H,41,42)(H,47,48)(H4,33,34,35)/t17-,21-,22-,23-,24-/m0/s1 InChIKey: XWJPDRPBQWTPKY-KELSAIANSA-N |
| Database reference: |