BIOPEP-UWM: Report
| ID | 9814 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 7 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 762.8514 | Monoisotopic mass | 762.4012 | |
| IC50 : | 1006.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ma F.-F., Wang H., Wei C.-K., Thakur K., Wei Z.-J., Jiang L. | |
| Title | |
| Three Novel ACE Inhibitory Peptides Isolated From Ginkgo biloba Seeds: Purification, Inhibitory Kinetic and Mechanism. Front. Pharmacol., 9, 1579, 2019 | |
| Year | Source |
| 2019 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(CC(=O)O)C(=O)NCC(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C(C)C)C(=O)O InChI=1S/C34H54N10O10/c1-17(2)26(43-29(49)21(35)12-9-13-38-34(36)37)32(52)42-22(14-20-10-7-6-8-11-20)31(51)41-23(15-25(46)47)30(50)39-16-24(45)40-19(5)28(48)44-27(18(3)4)33(53)54/h6-8,10-11,17-19,21-23,26-27H,9,12-16,35H2,1-5H3,(H,39,50)(H,40,45)(H,41,51)(H,42,52)(H,43,49)(H,44,48)(H,46,47)(H,53,54)(H4,36,37,38)/t19-,21-,22-,23-,26-,27-/m0/s1 InChIKey: VTLRXDHIWHEVPA-MLNOCLFBSA-N |
| Database reference: |