BIOPEP-UWM: Report
| ID | 9848 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 8 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 892.1763 | Monoisotopic mass | 891.6138 | |
| IC50 : | 237.43 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wang R., Zhao H., Pan X., Orfila C., Lu W., Ma Y. | |
| Title | |
| Preparation of bioactive peptides with antidiabetic, antihypertensive, and antioxidant activities and identification of α‐glucosidase inhibitory peptides from soy protein, Food Sci. Nutr., 7, 1848–1856, 2019 | |
| Year | Source |
| 2019 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C45H81N9O9/c1-25(2)21-30(47)38(55)50-33(23-27(5)6)43(60)53-19-13-16-35(53)40(57)51-34(24-28(7)8)44(61)54-20-14-17-36(54)41(58)52-37(29(9)10)42(59)49-32(22-26(3)4)39(56)48-31(45(62)63)15-11-12-18-46/h25-37H,11-24,46-47H2,1-10H3,(H,48,56)(H,49,59)(H,50,55)(H,51,57)(H,52,58)(H,62,63)/t30-,31-,32-,33-,34-,35-,36-,37-/m0/s1 InChIKey: RXBXXMJHSKBTDV-MDKUUQCZSA-N |
| Database reference: |