BIOPEP-UWM: Report
| ID | 9849 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 5 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 673.8014 | Monoisotopic mass | 673.3900 | |
| IC50 : | 182.05 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wang R., Zhao H., Pan X., Orfila C., Lu W., Ma Y. | |
| Title | |
| Preparation of bioactive peptides with antidiabetic, antihypertensive, and antioxidant activities and identification of α‐glucosidase inhibitory peptides from soy protein, Food Sci. Nutr., 7, 1848–1856, 2019 | |
| Year | Source |
| 2019 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CO)C(=O)N[C@@H](CC1=CNC2=CC=CC=C12)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])(CC(C)C)C(O)=O InChI=1S/C32H51N9O7/c1-17(2)12-24(29(45)38-23(10-7-11-36-32(34)35)28(44)41-26(31(47)48)13-18(3)4)40-30(46)25(39-27(43)21(33)16-42)14-19-15-37-22-9-6-5-8-20(19)22/h5-6,8-9,15,17-18,21,23-26,37,42H,7,10-14,16,33H2,1-4H3,(H,38,45)(H,39,43)(H,40,46)(H,41,44)(H,47,48)(H4,34,35,36)/t21-,23-,24-,25-,26-/m0/s1 InChIKey: PLOQWAOMSKWQOS-GKKOWRRISA-N |
| Database reference: |