BIOPEP-UWM: Report
| ID | 9855 |
| Name | Peptide stimulating mucin secretion |
| sequence |
| Function: | |||
| Peptide stimulating mucin secretion | |||
| Number of residues | 7 |
Activity code | sti |
| Activity : | stimulating |
|||
| Chemical mass | 836.8406 | Monoisotopic mass | 836.3539 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Plaisancié P., Boutrou R., Estienne M., Henry G., Jardin J., Paquet A., Léonil J. | |
| Title | |
| Beta-casein (94-123)-derived peptides differently modulate production of mucins in intestinal goblet cells. J. Dairy Res., 82, 36-46, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCC(=O)O)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)O InChI=1S/C36H52N8O15/c1-18(46)29(34(56)39-21(11-14-28(50)51)30(52)42-24(17-45)32(54)40-22(36(58)59)10-12-26(38)47)43-31(53)23(16-19-6-3-2-4-7-19)41-33(55)25-8-5-15-44(25)35(57)20(37)9-13-27(48)49/h2-4,6-7,18,20-25,29,45-46H,5,8-17,37H2,1H3,(H2,38,47)(H,39,56)(H,40,54)(H,41,55)(H,42,52)(H,43,53)(H,48,49)(H,50,51)(H,58,59)/t18-,20+,21+,22+,23+,24+,25+,29+/m1/s1 InChIKey=RAIKUYLMPRGJHO-KQEBIDDKSA-N |
| Database reference: |