BIOPEP-UWM: Report
| ID | 9858 |
| Name | Anti-inflammatory peptide |
| sequence |
| Function: | |||
| Anti-inflammatory | |||
| Number of residues | 4 |
Activity code | ai |
| Activity : | anti inflammatory |
|||
| Chemical mass | 431.4843 | Monoisotopic mass | 431.2162 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wang S., Zheng L., Zhao T., Zhang Q., Liu Y., Sun B., Su G., Zhao M. | |
| Title | |
| Inhibitory effects of walnut (Juglans regia) peptides on neuroinflammation and oxidative stress in lipopolysaccharide-induced cognitive impairment mice. J. Agric. Food Chem., 68, 2381-2392, 2020 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC(C)C)C(=O)NCC(=O)NCC(=O)N[C@@H](CC1=C[N]([H])C2=CC=CC=C12)C(=O)O InChI=1S/C21H29N5O5/c1-12(2)7-15(22)20(29)25-10-18(27)24-11-19(28)26-17(21(30)31)8-13-9-23-16-6-4-3-5-14(13)16/h3-6,9,12,15,17,23H,7-8,10-11,22H2,1-2H3,(H,24,27)(H,25,29)(H,26,28)(H,30,31)/t15-,17-/m0/s1 InChIKey=BAVJCCOOLSSQPO-RDJZCZTQSA-N |
| Database reference: |
| EROP-Moscow: ID E23776 |