BIOPEP-UWM: Report
| ID | 9862 |
| Name | Anti-inflammatory peptide |
| sequence |
| Function: | |||
| Anti-inflammatory | |||
| Number of residues | 5 |
Activity code | ai |
| Activity : | anti inflammatory |
|||
| Chemical mass | 586.6781 | Monoisotopic mass | 586.3105 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wang S., Zheng L., Zhao T., Zhang Q., Liu Y., Sun B., Su G., Zhao M. | |
| Title | |
| Inhibitory effects of walnut (Juglans regia) peptides on neuroinflammation and oxidative stress in lipopolysaccharide-induced cognitive impairment mice. J. Agric. Food Chem., 68, 2381-2392, 2020 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](C)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H]([C@H](O)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC2=C[N]([H])C3=CC=CC=C23)C(=O)O InChI=1S/C29H42N6O7/c1-15(2)12-21(25(37)33-22(29(41)42)13-18-14-31-20-9-6-5-8-19(18)20)32-27(39)24(17(4)36)34-26(38)23-10-7-11-35(23)28(40)16(3)30/h5-6,8-9,14-17,21-24,31,36H,7,10-13,30H2,1-4H3,(H,32,39)(H,33,37)(H,34,38)(H,41,42)/t16-,17+,21-,22-,23-,24-/m0/s1 InChIKey=BVIFPLZJGAIGTF-OBDLUUPQSA-N |
| Database reference: |
| EROP-Moscow: ID E23780 |