BIOPEP-UWM: Report
| ID | 9865 |
| Name | Anti-inflammatory peptide |
| sequence |
| Function: | |||
| Anti-inflammatory | |||
| Number of residues | 3 |
Activity code | ai |
| Activity : | anti inflammatory |
|||
| Chemical mass | 318.3271 | Monoisotopic mass | 318.1324 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wang S., Zheng L., Zhao T., Zhang Q., Liu Y., Sun B., Su G., Zhao M. | |
| Title | |
| Inhibitory effects of walnut (Juglans regia) peptides on neuroinflammation and oxidative stress in lipopolysaccharide-induced cognitive impairment mice. J. Agric. Food Chem., 68, 2381-2392, 2020 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)NCC(=O)N[C@@H](CC1=C[N]([H])C2=CC=CC=C12)C(=O)O InChI=1S/C15H18N4O4/c16-6-13(20)18-8-14(21)19-12(15(22)23)5-9-7-17-11-4-2-1-3-10(9)11/h1-4,7,12,17H,5-6,8,16H2,(H,18,20)(H,19,21)(H,22,23)/t12-/m0/s1 InChIKey=UPADCCSMVOQAGF-LBPRGKRZSA-N |
| Database reference: |
| ChemSpider: ID 29361662 EROP-Moscow: ID E23772 J-GLOBAL: ID 200907075919226277 Nikkaji: ID J1.691.866K PubChem: CID 36689348 |