BIOPEP-UWM: Report
| ID | 9873 |
| Name | Anti-inflammatory peptide |
| sequence |
| Function: | |||
| Anti-inflammatory | |||
| Number of residues | 8 |
Activity code | ai |
| Activity : | anti inflammatory |
|||
| Chemical mass | 889.9922 | Monoisotopic mass | 889.4643 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Millán-Linares M. C., Millán F., Pedroche J., Yust M. M. | |
| Title | |
| GPETAFLR: A new anti-inflammatory peptide from Lupinus angustifolius L. protein hydrolysate. Journal of Functional Foods, 18, 358-367, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H]([C@H](O)C)C(=O)N[C@@H](C)C(=O)N[C@@H](CC2=CC=CC=C2)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O InChI=1S/C40H63N11O12/c1-21(2)18-27(35(58)47-26(39(62)63)12-8-16-44-40(42)43)49-36(59)28(19-24-10-6-5-7-11-24)48-33(56)22(3)45-38(61)32(23(4)52)50-34(57)25(14-15-31(54)55)46-37(60)29-13-9-17-51(29)30(53)20-41/h5-7,10-11,21-23,25-29,32,52H,8-9,12-20,41H2,1-4H3,(H,45,61)(H,46,60)(H,47,58)(H,48,56)(H,49,59)(H,50,57)(H,54,55)(H,62,63)(H4,42,43,44)/t22-,23+,25-,26-,27-,28-,29-,32-/m0/s1 InChIKey=ONEKFNBUSFTJDF-OAQFWABKSA-N |
| Database reference: |