BIOPEP-UWM: Report
| ID | 9881 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidant | |||
| Number of residues | 4 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 445.4662 | Monoisotopic mass | 445.2165 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Sun C., Tang X., Ren Y., Wang E., Shi L., Wu X., Wu H. | |
| Title | |
| Novel antioxidant peptides purified from mulberry (Morus atropurpurea Roxb.) leaf protein hydrolysates with hemolysis inhibition ability and cellular antioxidant activity. J. Agric. Food Chem., 67, 7650-7659, 2019 | |
| Year | Source |
| 2019 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)O InChI=1S/C18H31N5O8/c1-8(2)14(17(29)22-11(18(30)31)5-6-12(20)24)23-15(27)9(3)21-16(28)10(19)4-7-13(25)26/h8-11,14H,4-7,19H2,1-3H3,(H2,20,24)(H,21,28)(H,22,29)(H,23,27)(H,25,26)(H,30,31)/t9-,10-,11-,14-/m0/s1 InChIKey=IDONFFQYCGVLFM-RMIALFOJSA-N |
| Database reference: |
| EROP-Moscow: ID E23708 |