BIOPEP-UWM: Report
| ID | 9883 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative peptide | |||
| Number of residues | 9 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1051.0618 | Monoisotopic mass | 1050.4602 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Tonolo F., Moretto L., Grinzato A., Fiorese F., Folda F., Scalcon V., Ferro S., Arrigoni G. et al. | |
| Title | |
| Fermented soy-derived bioactive peptides selected by a molecular docking approach show antioxidant properties involving the Keap1/Nrf2 pathway. Antioxidants, 9, 1306, 2020 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C)C(=O)NCC(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O InChI=1S/C44H66N12O18/c1-20(2)16-29(56-38(67)24(45)17-22-4-6-23(57)7-5-22)42(71)50-21(3)37(66)49-19-34(61)51-30(18-33(48)60)43(72)54-25(8-12-31(46)58)39(68)53-27(10-14-35(62)63)40(69)52-26(9-13-32(47)59)41(70)55-28(44(73)74)11-15-36(64)65/h4-7,20-21,24-30,57H,8-19,45H2,1-3H3,(H2,46,58)(H2,47,59)(H2,48,60)(H,49,66)(H,50,71)(H,51,61)(H,52,69)(H,53,68)(H,54,72)(H,55,70)(H,56,67)(H,62,63)(H,64,65)(H,73,74)/t21-,24-,25-,26-,27-,28-,29-,30-/m0/s1 InChIKey=MQMDIYYFABQRTP-DYYMGMNTSA-N |
| Database reference: |