BIOPEP-UWM: Report
| ID | 9886 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative peptide | |||
| Number of residues | 10 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1175.2482 | Monoisotopic mass | 1174.5713 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Tonolo F., Moretto L., Grinzato A., Fiorese F., Folda F., Scalcon V., Ferro S., Arrigoni G. et al. | |
| Title | |
| Fermented soy-derived bioactive peptides selected by a molecular docking approach show antioxidant properties involving the Keap1/Nrf2 pathway. Antioxidants, 9, 1306, 2020 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H]([C@H](CC)C)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC2=C[N]([H])C=N2)C(=O)N3[C@@H](CCC3)C(=O)N4[C@@H](CCC4)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O InChI=1S/C50H78N16O17/c1-3-25(2)39(63-42(75)28(12-14-36(52)68)59-41(74)29(13-15-37(69)70)58-40(73)27(51)21-38(71)72)48(81)65-18-6-10-34(65)45(78)62-32(23-67)43(76)61-31(20-26-22-55-24-57-26)46(79)66-19-7-11-35(66)47(80)64-17-5-9-33(64)44(77)60-30(49(82)83)8-4-16-56-50(53)54/h22,24-25,27-35,39,67H,3-21,23,51H2,1-2H3,(H2,52,68)(H,55,57)(H,58,73)(H,59,74)(H,60,77)(H,61,76)(H,62,78)(H,63,75)(H,69,70)(H,71,72)(H,82,83)(H4,53,54,56)/t25-,27-,28-,29-,30-,31-,32-,33-,34-,35-,39-/m0/s1 InChIKey=LDKMSDBQBSCIJS-WCRHHVROSA-N |
| Database reference: |