BIOPEP-UWM: Report
| ID | 9898 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative peptide | |||
| Number of residues | 9 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1025.1946 | Monoisotopic mass | 1024.5575 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Tonolo F., Fiorese F., Moretto L., Folda A., Scalcon V., Grinzato A., Ferro S. et al. | |
| Title | |
| Identification of new peptides from fermented milk showing antioxidant properties: mechanism of action. Antioxidants, 9, 117, 2020 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O InChI=1S/C50H76N10O13/c1-27(2)25-33(42(64)53-31(18-20-38(51)61)47(69)58-22-10-15-35(58)44(66)54-32(50(72)73)19-21-39(62)63)55-43(65)34(26-30-13-8-7-9-14-30)56-45(67)36-16-11-23-59(36)48(70)37-17-12-24-60(37)49(71)41(29(5)6)57-46(68)40(52)28(3)4/h7-9,13-14,27-29,31-37,40-41H,10-12,15-26,52H2,1-6H3,(H2,51,61)(H,53,64)(H,54,66)(H,55,65)(H,56,67)(H,57,68)(H,62,63)(H,72,73)/t31-,32-,33-,34-,35-,36-,37-,40-,41-/m0/s1 InChIKey=XJKCILBJQZOYFW-XEZUIKAVSA-N |
| Database reference: |