BIOPEP-UWM: Report
| ID | 9908 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 325.4022 | Monoisotopic mass | 325.1995 | |
| IC50 : | 427.15 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wang Z., Zhang S., Jin H., Wang W., Huo J., Zhou L., Wang Y., Feng F., Zhang L. | |
| Title | |
| Angiotensin-I-converting enzyme inhibitory peptides: Chemical feature based pharmacophore generation. Eur. J. Med. Chem., 46, 3428-3433, 2011 | |
| Year | Source |
| 2011 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C16H27N3O4/c1-10(2)9-12(16(22)23)18-14(20)13-6-4-8-19(13)15(21)11-5-3-7-17-11/h10-13,17H,3-9H2,1-2H3,(H,18,20)(H,22,23)/t11-,12-,13-/m0/s1 InChIKey=CGSOWZUPLOKYOR-AVGNSLFASA-N Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the BIOPEP-UWM database of bioactive peptides (ID 8652) |
| Database reference: |
| AHTPDB: ID ahtpdb_1957 BindingDB: ID 50348859 BioPepDB: ID biopep01080 BIOPEP-UWM database of bioactive peptides: ID 8652 ChEBI: ID 162598 ChEMBL: ID CHEMBL1807691 ChemSpider: ID 10032763 EROP-Moscow: ID E26062 FeptideDB: ID 8652 J-GLOBAL: ID 201507031190847837 Nikkaji: ID J3.367.833I PubChem: CID 11858292 SATPdb: ID satpdb10190 ZINC: ID ZINC000036489331 |