BIOPEP-UWM: Report
| ID | 9913 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidant | |||
| Number of residues | 6 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 616.8125 | Monoisotopic mass | 616.3606 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Li T., Shi C., Zhou C., Sun X., Ang Y., Dong X., Huang M., Zhou G. | |
| Title | |
| Purification and characterization of novel antioxidant peptides from duck breast protein hydrolysates. LWT, 125, 109215, 2020 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CS)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C(C)C)C(=O)O InChI=1S/C28H52N6O7S/c1-13(2)10-18(29)24(36)31-19(11-14(3)4)25(37)32-20(12-42)26(38)33-21(15(5)6)27(39)30-17(9)23(35)34-22(16(7)8)28(40)41/h13-22,42H,10-12,29H2,1-9H3,(H,30,39)(H,31,36)(H,32,37)(H,33,38)(H,34,35)(H,40,41)/t17-,18-,19-,20-,21-,22-/m0/s1 InChIKey=XIYVMDWCOABJQZ-WLNPFYQQSA-N |
| Database reference: |