BIOPEP-UWM: Report
| ID | 9919 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative peptide | |||
| Number of residues | 10 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1179.2774 | Monoisotopic mass | 1178.4566 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Hu S., Yuan J., Gao J., Wu Y., Meng X., Tong P., Chen H. | |
| Title | |
| Antioxidant and anti-inflammatory potential of peptides derived from in vitro gastrointestinal digestion of germinated and heat-treated foxtail millet (Setaria italica) proteins. J. Agric. Food Chem., 68, 9415–9426, 2020 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C46H74N12O20S2/c1-22(37(68)54-27(46(77)78)7-4-5-15-47)50-39(70)25(13-17-79-2)53-44(75)31-8-6-16-58(31)45(76)30(21-36(66)67)57-41(72)26(14-18-80-3)52-40(71)24(10-11-32(49)59)51-42(73)29(20-35(64)65)56-43(74)28(19-34(62)63)55-38(69)23(48)9-12-33(60)61/h22-31H,4-21,47-48H2,1-3H3,(H2,49,59)(H,50,70)(H,51,73)(H,52,71)(H,53,75)(H,54,68)(H,55,69)(H,56,74)(H,57,72)(H,60,61)(H,62,63)(H,64,65)(H,66,67)(H,77,78)/t22-,23-,24-,25-,26-,27-,28-,29-,30-,31-/m0/s1 InChIKey=UMJCJMWDIKSQQL-ACNOIZITSA-N Anti-inflammatory peptide according to the BIOPEP-UWM database of bioactive peptides (ID 9920) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 9920 |