BIOPEP-UWM: Report
| ID | 9924 |
| Name | Anti-adipogenetic peptide |
| sequence |
| Function: | |||
| Inhibitor of metabolic pathways involved in adipogenesis in cel cultures | |||
| Number of residues | 12 |
Activity code | inh |
| Activity : | inhibitor |
|||
| Chemical mass | 1249.2836 | Monoisotopic mass | 1248.5716 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Grancieri M., Duarte Martino H. S., Gonzalez de Mejia E. | |
| Title | |
| Protein digests and pure peptides from chia seed prevented adipogenesis and inflammation by inhibiting PPARgamma and NF-kappaB pathways in 3T3L-1 adipocytes. Nutrients, 13, 176, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CO)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)O InChI=1S/C52H80N16O20/c1-23(2)14-29(44(79)62-31(17-39(73)74)46(81)60-28(52(87)88)10-11-36(54)70)61-42(77)25(5)59-50(85)41(24(3)4)66-47(82)32(18-40(75)76)63-45(80)30(15-26-19-56-22-58-26)64-49(84)35-9-6-12-67(35)38(72)20-57-48(83)34-8-7-13-68(34)51(86)33(21-69)65-43(78)27(53)16-37(55)71/h19,22-25,27-35,41,69H,6-18,20-21,53H2,1-5H3,(H2,54,70)(H2,55,71)(H,56,58)(H,57,83)(H,59,85)(H,60,81)(H,61,77)(H,62,79)(H,63,80)(H,64,84)(H,65,78)(H,66,82)(H,73,74)(H,75,76)(H,87,88)/t25-,27-,28-,29-,30-,31-,32-,33-,34-,35-,41-/m0/s1 InChIKey=AXXQVJHTFXAECG-YQXCQCMMSA-N Anti-inflammatory peptide according to the BIOPEP-UWM database of bioactive peptides (ID 9923) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 9923 |