BIOPEP-UWM: Report
| ID | 9927 |
| Name | DPPIV inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 8 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 878.9234 | Monoisotopic mass | 878.4120 | |
| IC50 : | 409.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Theysgeur S., Cudennec B., Deracinois B., Perrin C., Guiller I., Lepoudère A., Flahaut C., Ravallec R. | |
| Title | |
| New bioactive peptides identified from a tilapia byproduct hydrolysate exerting effects on DPP-IV activity and intestinal hormones regulation after canine gastrointestinal simulated digestion. Molecules, 26, 136, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](C(C)C)C(=O)N[C@@H](C)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC2=C[N]([H])C=N2)C(=O)N3[C@@H](CCC3)C(=O)N[C@@H]([C@H](O)C)C(=O)O InChI=1S/C38H58N10O14/c1-18(2)29(39)35(58)42-19(3)36(59)47-13-5-7-25(47)33(56)44-23(10-12-28(52)53)31(54)43-22(9-11-27(50)51)32(55)45-24(15-21-16-40-17-41-21)37(60)48-14-6-8-26(48)34(57)46-30(20(4)49)38(61)62/h16-20,22-26,29-30,49H,5-15,39H2,1-4H3,(H,40,41)(H,42,58)(H,43,54)(H,44,56)(H,45,55)(H,46,57)(H,50,51)(H,52,53)(H,61,62)/t19-,20+,22-,23-,24-,25-,26-,29-,30-/m0/s1 InChIKey=ZECYSAJQCPOXKX-ICUBCQCDSA-N |
| Database reference: |