BIOPEP-UWM: Report
| ID | 9928 |
| Name | DPPIV inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 8 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 862.9863 | Monoisotopic mass | 862.4091 | |
| IC50 : | 603.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Theysgeur S., Cudennec B., Deracinois B., Perrin C., Guiller I., Lepoudère A., Flahaut C., Ravallec R. | |
| Title | |
| New bioactive peptides identified from a tilapia byproduct hydrolysate exerting effects on DPP-IV activity and intestinal hormones regulation after canine gastrointestinal simulated digestion. Molecules, 26, 136, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)O InChI=1S/C36H62N8O14S/c1-15(2)25(37)33(54)38-18(7)29(50)41-22(14-24(48)49)32(53)44-28(19(8)45)35(56)40-21(12-13-59-9)30(51)39-20(10-11-23(46)47)31(52)42-26(16(3)4)34(55)43-27(17(5)6)36(57)58/h15-22,25-28,45H,10-14,37H2,1-9H3,(H,38,54)(H,39,51)(H,40,56)(H,41,50)(H,42,52)(H,43,55)(H,44,53)(H,46,47)(H,48,49)(H,57,58)/t18-,19+,20-,21-,22-,25-,26-,27-,28-/m0/s1 InChIKey=VYWBFQUVIXLIKM-UNTGQMNCSA-N |
| Database reference: |