BIOPEP-UWM: Report
| ID | 9930 |
| Name | DPPIV inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 4 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 482.5504 | Monoisotopic mass | 482.1828 | |
| IC50 : | 775.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Theysgeur S., Cudennec B., Deracinois B., Perrin C., Guiller I., Lepoudère A., Flahaut C., Ravallec R. | |
| Title | |
| New bioactive peptides identified from a tilapia byproduct hydrolysate exerting effects on DPP-IV activity and intestinal hormones regulation after canine gastrointestinal simulated digestion. Molecules, 26, 136, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(CC(=O)O)C(=O)O InChI=1S/C21H30N4O7S/c1-12(23-19(29)14(22)10-13-6-4-3-5-7-13)18(28)24-15(8-9-33-2)20(30)25-16(21(31)32)11-17(26)27/h3-7,12,14-16H,8-11,22H2,1-2H3,(H,23,29)(H,24,28)(H,25,30)(H,26,27)(H,31,32)/t12-,14-,15-,16-/m0/s1 InChIKey=VYABMJZUZMWFTR-TUUVXOQKSA-N |
| Database reference: |