BIOPEP-UWM: Report
| ID | 9931 |
| Name | DPPIV inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 7 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 741.9148 | Monoisotopic mass | 741.4411 | |
| IC50 : | 263.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Theysgeur S., Cudennec B., Deracinois B., Perrin C., Guiller I., Lepoudère A., Flahaut C., Ravallec R. | |
| Title | |
| New bioactive peptides identified from a tilapia byproduct hydrolysate exerting effects on DPP-IV activity and intestinal hormones regulation after canine gastrointestinal simulated digestion. Molecules, 26, 136, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)O InChI=1S/C38H59N7O8/c1-22(2)18-26(33(47)40-27(19-23(3)4)34(48)43-32(24(5)6)38(52)53)41-36(50)30-15-11-17-45(30)37(51)28(20-25-12-8-7-9-13-25)42-35(49)29-14-10-16-44(29)31(46)21-39/h7-9,12-13,22-24,26-30,32H,10-11,14-21,39H2,1-6H3,(H,40,47)(H,41,50)(H,42,49)(H,43,48)(H,52,53)/t26-,27-,28-,29-,30-,32-/m0/s1 InChIKey=RNGAAKZGZWJBDO-RUAREOIKSA-N |
| Database reference: |