BIOPEP-UWM: Report
| ID | 9932 |
| Name | Stimulating cholecystokinin release |
| sequence |
| Function: | |||
| Stimulating cholecystokinin release | |||
| Number of residues | 5 |
Activity code | sti |
| Activity : | stimulating |
|||
| Chemical mass | 588.6493 | Monoisotopic mass | 588.3108 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Theysgeur S., Cudennec B., Deracinois B., Perrin C., Guiller I., Lepoudère A., Flahaut C., Ravallec R. | |
| Title | |
| New bioactive peptides identified from a tilapia byproduct hydrolysate exerting effects on DPP-IV activity and intestinal hormones regulation after canine gastrointestinal simulated digestion. Molecules, 26, 136, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C25H44N6O10/c1-12(2)9-16(29-21(36)14(27)10-18(32)33)23(38)31-20(13(3)4)24(39)30-17(11-19(34)35)22(37)28-15(25(40)41)7-5-6-8-26/h12-17,20H,5-11,26-27H2,1-4H3,(H,28,37)(H,29,36)(H,30,39)(H,31,38)(H,32,33)(H,34,35)(H,40,41)/t14-,15-,16-,17-,20-/m0/s1 InChIKey=VXWRMWVOZWPECK-LLYLOPHFSA-N |
| Database reference: |