BIOPEP-UWM: Report
| ID | 9933 |
| Name | Stimulating cholecystokinin release |
| sequence |
| Function: | |||
| Stimulating cholecystokinin release | |||
| Number of residues | 5 |
Activity code | sti |
| Activity : | stimulating |
|||
| Chemical mass | 551.6341 | Monoisotopic mass | 551.3058 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Theysgeur S., Cudennec B., Deracinois B., Perrin C., Guiller I., Lepoudère A., Flahaut C., Ravallec R. | |
| Title | |
| New bioactive peptides identified from a tilapia byproduct hydrolysate exerting effects on DPP-IV activity and intestinal hormones regulation after canine gastrointestinal simulated digestion. Molecules, 26, 136, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@H](CCC1)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC2=C[N]([H])C=N2)C(=O)O InChI=1S/C25H41N7O7.C2H6/c1-13(2)8-17(29-23(36)19(11-33)31-21(34)16-6-5-7-27-16)22(35)32-20(14(3)4)24(37)30-18(25(38)39)9-15-10-26-12-28-15;1-2/h10,12-14,16-20,27,33H,5-9,11H2,1-4H3,(H,26,28)(H,29,36)(H,30,37)(H,31,34)(H,32,35)(H,38,39);1-2H3/t16-,17-,18-,19-,20-;/m0./s1 InChIKey=RYDBPGNGEUBQHU-HCDNWCCTSA-N |
| Database reference: |