BIOPEP-UWM: Report
| ID | 9934 |
| Name | Stimulating GLP-1 release |
| sequence |
| Function: | |||
| Stimulating release of Glucagon-like peptide 1 | |||
| Number of residues | 4 |
Activity code | sti |
| Activity : | stimulating |
|||
| Chemical mass | 457.5627 | Monoisotopic mass | 457.2891 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Theysgeur S., Cudennec B., Deracinois B., Perrin C., Guiller I., Lepoudère A., Flahaut C., Ravallec R. | |
| Title | |
| New bioactive peptides identified from a tilapia byproduct hydrolysate exerting effects on DPP-IV activity and intestinal hormones regulation after canine gastrointestinal simulated digestion. Molecules, 26, 136, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCCN)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)O InChI=1S/C21H39N5O6/c1-12(2)11-14(23)18(28)24-15(7-4-5-9-22)20(30)26-10-6-8-16(26)19(29)25-17(13(3)27)21(31)32/h12-17,27H,4-11,22-23H2,1-3H3,(H,24,28)(H,25,29)(H,31,32)/t13-,14+,15+,16+,17+/m1/s1 InChIKey=RFVLSUZPBLJFHP-XAJHFOFHSA-N |
| Database reference: |