BIOPEP-UWM: Report
| ID | 9935 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 8 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 961.0303 | Monoisotopic mass | 960.4763 | |
| IC50 : | 50.88 µM |
|||
| Bibliographic data: | |
| Authors | |
| Sonklin C, Alashi AM, Laohakunjit L, Kerdchoechuen O, Aluko RE. | |
| Title | |
| Identification of antihypertensive peptides from mung bean protein hydrolysate and their effects in spontaneously hypertensive rats. J. Funct. Foods 64, 103635, 2020 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[N]([H])C=N1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(=O)N)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC2=C[N]([H])C=N2)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(=O)N)C(=O)O InChI=1S/C41H64N14O13/c1-18(2)9-25(50-34(60)23(42)10-21-14-45-16-47-21)36(62)51-27(12-29(43)56)38(64)54-33(20(5)6)40(66)55-32(19(3)4)39(65)52-26(11-22-15-46-17-48-22)37(63)49-24(7-8-31(58)59)35(61)53-28(41(67)68)13-30(44)57/h14-20,23-28,32-33H,7-13,42H2,1-6H3,(H2,43,56)(H2,44,57)(H,45,47)(H,46,48)(H,49,63)(H,50,60)(H,51,62)(H,52,65)(H,53,61)(H,54,64)(H,55,66)(H,58,59)(H,67,68)/t23-,24-,25-,26-,27-,28-,32-,33-/m0/s1 InChIKey= CUSVJDKRDBZYEO-TUQKNVKFSA-N |
| Database reference: |
| EROP-Moscow: ID E24391 |